cas: 86-87-3 — see every product listed under this CAS number, including other names
1-Naphthaleneacetic acid, 99.89% (CAS 86-87-3) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 10mM/1mL, 25 g, 1 kg, 10 g, 500 g, 5 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-18570-50 g |
| cas | 86-87-3 |
| size | 50 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 505.45 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 25 g | 407.93 Pln | |
| MedChemExpress | 1 kg | 1369.24 Pln | |
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 500 g | 1081.31 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 100 g | 621.55 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.89% |
1-naphthaleneacetic acid is a naphthylacetic acid substituted by a carboxymethyl group at position 1. It has a role as a synthetic auxin. It is a conjugate acid of a 1-naphthaleneacetate.
Source: ChEBI
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-naphthalen-1-ylacetic acid |
| InChIKey | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)O |
Computed by PubChem (NCBI)