CAS 3669-52-1 appears in our catalog under these names: 1-(4-Hydroxynaphthalen-1-yl)ethan-1-one, 95%, 1-(4-Hydroxynaphthalen-1-yl)ethanone, 95%, 4–Acetyl–1–naphthol, 4-Acetyl-1-naphthol, 4-Acetyl-1-naphthol, 95%, 95%. Offered by: Combi-blocks, Fluorochem, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
1-(4-hydroxynaphthalen-1-yl)ethanone (CAS 3669-52-1) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 1-(4-hydroxynaphthalen-1-yl)ethanone. InChIKey: SAPGSAHOBOEJDV-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 1-(4-hydroxynaphthalen-1-yl)ethanone |
| InChIKey | SAPGSAHOBOEJDV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C2=CC=CC=C21)O |
Computed by PubChem (NCBI)