1-Naphthoic acid 98%
cas: 86-55-5 — see every product listed under this CAS number, including other names
1-Naphthoic acid 98% (CAS 86-55-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A173386-5g |
| cas | 86-55-5 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 320.31 Pln | |
| Ambeed | 500g | 637.38 Pln | |
| Ambeed | 1000g | 1193.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A173386 |
1-naphthoic acid is a naphthoic acid carrying a carboxy group at position 1. It has a role as a fungal xenobiotic metabolite and a bacterial xenobiotic metabolite. It is a conjugate acid of a 1-naphthoate.
Source: ChEBI
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | naphthalene-1-carboxylic acid |
| InChIKey | LNETULKMXZVUST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)O |
Computed by PubChem (NCBI)