Products 634179-80-9
CAS 634179-80-9 appears in our catalog under these names: 1-Naphthoic Acid-d7, >95% (HPLC), 1-Naphthoic acid-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 100 mg, 1 g.
2,3,4,5,6,7,8-heptadeuterionaphthalene-1-carboxylic acid (CAS 634179-80-9) is a chemical compound with the molecular formula C11H8O2 and a molecular weight of 179.22 g/mol. IUPAC name: 2,3,4,5,6,7,8-heptadeuterionaphthalene-1-carboxylic acid. InChIKey: LNETULKMXZVUST-GSNKEKJESA-N.
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2,3,4,5,6,7,8-heptadeuterionaphthalene-1-carboxylic acid |
| InChIKey | LNETULKMXZVUST-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2C(=O)O)[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)