cas: 86-55-5 — see every product listed under this CAS number, including other names
1-Naphthoic acid, 98%, 98% (CAS 86-55-5) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 1kg, 5kg, 10kg, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EJF-50g |
| cas | 86-55-5 |
| size | 50g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 88.40 Pln | |
| Chemat | 250g | 189.20 Pln | |
| Chemat | 1kg | 506.00 Pln | |
| Chemat | 5kg | 2755.20 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 112.40 Pln | |
| Chemat | 500g | 379.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-naphthoic acid is a naphthoic acid carrying a carboxy group at position 1. It has a role as a fungal xenobiotic metabolite and a bacterial xenobiotic metabolite. It is a conjugate acid of a 1-naphthoate.
Source: ChEBI
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | naphthalene-1-carboxylic acid |
| InChIKey | LNETULKMXZVUST-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)O |
Computed by PubChem (NCBI)