CAS 93261-39-3 appears in our catalog under these names: 1-Naphthyl 3,5-dinitrobenzoate/ 97.42% (existing batch purity), 1–Naphthyl 3,5–dinitrobenzoate, JMC-4, 1-Naphthyl 3,5-dinitrobenzoate, 1-Naphthyl 3,5-dinitrobenzoate, 99.49%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
Naphthalen-1-yl 3,5-dinitrobenzoate (CAS 93261-39-3) is a chemical compound with the molecular formula C17H10N2O6 and a molecular weight of 338.27 g/mol. IUPAC name: naphthalen-1-yl 3,5-dinitrobenzoate. InChIKey: WYKPSINHJUWDHK-UHFFFAOYSA-N.
| Molecular formula | C17H10N2O6 |
|---|---|
| Molecular weight | 338.27 g/mol |
| IUPAC name | naphthalen-1-yl 3,5-dinitrobenzoate |
| InChIKey | WYKPSINHJUWDHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OC(=O)C3=CC(=CC(=C3)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)