cas: 830-81-9 — see every product listed under this CAS number, including other names
1-Naphthyl acetate, 99.98% (CAS 830-81-9) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 1 g, 100 g, 25 g, 5 g, 50 g, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W016188-10 g |
| cas | 830-81-9 |
| size | 10 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 505.45 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 100 g | 1081.31 Pln | |
| MedChemExpress | 25 g | 695.86 Pln | |
| MedChemExpress | 5 g | 407.93 Pln | |
| MedChemExpress | 50 g | 863.04 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
Naphthalen-1-yl acetate (CAS 830-81-9) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: naphthalen-1-yl acetate. InChIKey: VGKONPUVOVVNSU-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | naphthalen-1-yl acetate |
| InChIKey | VGKONPUVOVVNSU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)