1-Nitro-4-octylbenzene, 98%
cas: 78723-40-7 — see every product listed under this CAS number, including other names
1-Nitro-4-octylbenzene, 98% (CAS 78723-40-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1685094-250mg |
| cas | 78723-40-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1677.56 Pln | |
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1245.20 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 714.22 Pln | |
| BLDpharm | 1g | 1802.72 Pln | |
| Fluorochem | 100mg | 586.27 Pln | |
| Fluorochem | 250mg | 919.49 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-nitro-4-octylbenzene (CAS 78723-40-7) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: 1-nitro-4-octylbenzene. InChIKey: BPXPAHOYZITTII-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | 1-nitro-4-octylbenzene |
| InChIKey | BPXPAHOYZITTII-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)