CAS 955-03-3 appears in our catalog under these names: 2,6-Di-tert-butyl-4-nitrosophenol, 95%, 2,6-di-tert-butyl-4-nitrosophenol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
2,6-ditert-butyl-4-nitrosophenol (CAS 955-03-3) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: 2,6-ditert-butyl-4-nitrosophenol. InChIKey: JLOKPJOOVQELMO-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-nitrosophenol |
| InChIKey | JLOKPJOOVQELMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)N=O |
Computed by PubChem (NCBI)