cas: 105678-29-3 — see every product listed under this CAS number, including other names
1-PIPERIDINECARBOXYLIC ACID, 2,6-DIMETHYL-, 1,1-DIMETHYLETHYL ESTER, 95%+, 95%+ (CAS 105678-29-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118DLL-250mg |
| cas | 105678-29-3 |
| size | 250mg |
| availability | 2.35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 237.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,6-dimethylpiperidine-1-carboxylate (CAS 105678-29-3) is a chemical compound with the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. IUPAC name: tert-butyl 2,6-dimethylpiperidine-1-carboxylate. InChIKey: XFHDOSGLKQJYLP-UHFFFAOYSA-N.
| Molecular formula | C12H23NO2 |
|---|---|
| Molecular weight | 213.32 g/mol |
| IUPAC name | tert-butyl 2,6-dimethylpiperidine-1-carboxylate |
| InChIKey | XFHDOSGLKQJYLP-UHFFFAOYSA-N |
| SMILES | CC1CCCC(N1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)