cas: 105678-29-3 — see every product listed under this CAS number, including other names
Tert-butyl 2,6-dimethylpiperidine-1-carboxylate (CAS 105678-29-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F706334-250MG |
| cas | 105678-29-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 362.39 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 2,6-dimethylpiperidine-1-carboxylate (CAS 105678-29-3) is a chemical compound with the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. IUPAC name: tert-butyl 2,6-dimethylpiperidine-1-carboxylate. InChIKey: XFHDOSGLKQJYLP-UHFFFAOYSA-N.
| Molecular formula | C12H23NO2 |
|---|---|
| Molecular weight | 213.32 g/mol |
| IUPAC name | tert-butyl 2,6-dimethylpiperidine-1-carboxylate |
| InChIKey | XFHDOSGLKQJYLP-UHFFFAOYSA-N |
| SMILES | CC1CCCC(N1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)