1-Pyrenecarboxylic acid, 97%
cas: 19694-02-1 — see every product listed under this CAS number, including other names
1-Pyrenecarboxylic acid, 97% (CAS 19694-02-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem, Ambeed.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 473950010 |
| cas | 19694-02-1 |
| size | 1g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 298.89 Pln | |
| Thermo Scientific (Acros) | 5g | 1126.98 Pln | |
| Sigma-Aldrich | 1G | 474.00 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 25g | 2215.90 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 537.25 Pln | |
| Ambeed | 25g | 2395.12 Pln | |
| Ambeed | 100g | 7507.06 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Pyrene-1-carboxylic acid (CAS 19694-02-1) is a chemical compound with the molecular formula C17H10O2 and a molecular weight of 246.26 g/mol. IUPAC name: pyrene-1-carboxylic acid. InChIKey: HYISVWRHTUCNCS-UHFFFAOYSA-N.
| Molecular formula | C17H10O2 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | pyrene-1-carboxylic acid |
| InChIKey | HYISVWRHTUCNCS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C(=O)O |
Computed by PubChem (NCBI)