CAS 55377-35-0 is the registry number for 6H-Dibenzo(c,h)chromen-6-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
Naphtho[1,2-c]isochromen-6-one (CAS 55377-35-0) is a chemical compound with the molecular formula C17H10O2 and a molecular weight of 246.26 g/mol. IUPAC name: naphtho[1,2-c]isochromen-6-one. InChIKey: LLWVLKBCZLXSNJ-UHFFFAOYSA-N.
| Molecular formula | C17H10O2 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | naphtho[1,2-c]isochromen-6-one |
| InChIKey | LLWVLKBCZLXSNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2OC(=O)C4=CC=CC=C34 |
Computed by PubChem (NCBI)