cas: 17507-05-0 — see every product listed under this CAS number, including other names
1-Phenyl-1,2-dihydroisoquinolin-3(4H)-one 97% (CAS 17507-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205391-250mg |
| cas | 17507-05-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1354.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A205391 |
1-phenyl-2,4-dihydro-1H-isoquinolin-3-one (CAS 17507-05-0) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 1-phenyl-2,4-dihydro-1H-isoquinolin-3-one. InChIKey: IAOCKKZVKNCZPK-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 1-phenyl-2,4-dihydro-1H-isoquinolin-3-one |
| InChIKey | IAOCKKZVKNCZPK-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)