cas: 34296-51-0 — see every product listed under this CAS number, including other names
1-Phenyl-1H-1,2,3-triazole-4-carbaldehyde, 95+%, 95+% (CAS 34296-51-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CJCW-50mg |
| cas | 34296-51-0 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 227.60 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 568.40 Pln | |
| Chemat | 1g | 1427.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-phenyltriazole-4-carbaldehyde (CAS 34296-51-0) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: 1-phenyltriazole-4-carbaldehyde. InChIKey: AQBWYVZHTYJMES-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 1-phenyltriazole-4-carbaldehyde |
| InChIKey | AQBWYVZHTYJMES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(N=N2)C=O |
Computed by PubChem (NCBI)