CAS 1261399-02-3 is the registry number for (E)-1,5-Naphthyridine-3-carbaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(NE)-N-(1,5-naphthyridin-3-ylmethylidene)hydroxylamine (CAS 1261399-02-3) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: (NE)-N-(1,5-naphthyridin-3-ylmethylidene)hydroxylamine. InChIKey: FMZOILUSDDPPFA-WUXMJOGZSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (NE)-N-(1,5-naphthyridin-3-ylmethylidene)hydroxylamine |
| InChIKey | FMZOILUSDDPPFA-WUXMJOGZSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)/C=N/O)N=C1 |
Computed by PubChem (NCBI)