cas: 6002-15-9 — see every product listed under this CAS number, including other names
1-Phenyl-1H-imidazole-2-carbaldehyde, 97% (CAS 6002-15-9) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC75904CB |
| cas | 6002-15-9 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 428.65 Pln | |
| Thermo Scientific | 1g | 1201.43 Pln | |
| Thermo Scientific | 5g | 3487.20 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-phenylimidazole-2-carbaldehyde (CAS 6002-15-9) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 1-phenylimidazole-2-carbaldehyde. InChIKey: VJDRBJPZIHUDNE-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 1-phenylimidazole-2-carbaldehyde |
| InChIKey | VJDRBJPZIHUDNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=CN=C2C=O |
Computed by PubChem (NCBI)