cas: 210825-11-9 — see every product listed under this CAS number, including other names
1-Phenyl-3-(thiophen-2-yl)-1H-pyrazole-4-carbaldehyde, 97%, 97% (CAS 210825-11-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113KZ7-50mg |
| cas | 210825-11-9 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 486.80 Pln | |
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 250mg | 971.60 Pln | |
| Chemat | 500mg | 1619.60 Pln | |
| Chemat | 1g | 1878.80 Pln | |
| Chemat | 5g | 5685.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-phenyl-3-thiophen-2-ylpyrazole-4-carbaldehyde (CAS 210825-11-9) is a chemical compound with the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. IUPAC name: 1-phenyl-3-thiophen-2-ylpyrazole-4-carbaldehyde. InChIKey: HVDFEBGVPKLCCY-UHFFFAOYSA-N.
| Molecular formula | C14H10N2OS |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 1-phenyl-3-thiophen-2-ylpyrazole-4-carbaldehyde |
| InChIKey | HVDFEBGVPKLCCY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=CS3)C=O |
Computed by PubChem (NCBI)