CAS 930053-64-8 is the registry number for N-(Quinolin-8-yl)thiophene-3-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
N-quinolin-8-ylthiophene-3-carboxamide (CAS 930053-64-8) is a chemical compound with the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. IUPAC name: N-quinolin-8-ylthiophene-3-carboxamide. InChIKey: KYYFHBLENVMTPZ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2OS |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | N-quinolin-8-ylthiophene-3-carboxamide |
| InChIKey | KYYFHBLENVMTPZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NC(=O)C3=CSC=C3)N=CC=C2 |
Computed by PubChem (NCBI)