cas: 125802-37-1 — see every product listed under this CAS number, including other names
1-Phenylcycloheptanamine hydrochloride 95% (CAS 125802-37-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181706-5g |
| cas | 125802-37-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 10g | 898.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A181706 |
1-phenylcycloheptan-1-amine;hydrochloride (CAS 125802-37-1) is a chemical compound with the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. IUPAC name: 1-phenylcycloheptan-1-amine;hydrochloride. InChIKey: JKZJEZPOTKKDJC-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN |
|---|---|
| Molecular weight | 225.76 g/mol |
| IUPAC name | 1-phenylcycloheptan-1-amine;hydrochloride |
| InChIKey | JKZJEZPOTKKDJC-UHFFFAOYSA-N |
| SMILES | C1CCCC(CC1)(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)