Products 58271-62-8
CAS 58271-62-8 appears in our catalog under these names: 1-Cyclohexyl-1-phenylmethanamine hydrochloride, 95%, Cyclohexyl(phenyl)methanamine hydrochloride, 95%, Cyclohexyl(phenyl)methanamine hydrochloride, cyclohexyl(phenyl)methanamine hydrochloride, 98%, 98%, Cyclohexyl(phenyl)methanamine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g.
Cyclohexyl(phenyl)methanamine;hydrochloride (CAS 58271-62-8) is a chemical compound with the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. IUPAC name: cyclohexyl(phenyl)methanamine;hydrochloride. InChIKey: INIQGHHKHOQSIT-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN |
|---|---|
| Molecular weight | 225.76 g/mol |
| IUPAC name | cyclohexyl(phenyl)methanamine;hydrochloride |
| InChIKey | INIQGHHKHOQSIT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)