cas: 919347-67-4 — see every product listed under this CAS number, including other names
1-Piperazinecarboxylic acid, 4-(5-borono-2-pyridinyl)-, 1-(1,1-dimethylethyl) ester, 98%, 98% (CAS 919347-67-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BYI-100mg |
| cas | 919347-67-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 25g | 2944.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid (CAS 919347-67-4) is a chemical compound with the molecular formula C14H22BN3O4 and a molecular weight of 307.16 g/mol. IUPAC name: [6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid. InChIKey: SYZMMRYQYWCLNC-UHFFFAOYSA-N.
| Molecular formula | C14H22BN3O4 |
|---|---|
| Molecular weight | 307.16 g/mol |
| IUPAC name | [6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid |
| InChIKey | SYZMMRYQYWCLNC-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)