cas: 919347-67-4 — see every product listed under this CAS number, including other names
2–(4–N–Boc–piperazino)pyridine–5–boronic acid (CAS 919347-67-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD18939-1g |
| cas | 919347-67-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 802.98 Pln | |
| GLPBio | 250mg | 564.28 Pln | |
| GLPBio | 25g | 7645.87 Pln | |
| GLPBio | 5g | 2202.45 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid (CAS 919347-67-4) is a chemical compound with the molecular formula C14H22BN3O4 and a molecular weight of 307.16 g/mol. IUPAC name: [6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid. InChIKey: SYZMMRYQYWCLNC-UHFFFAOYSA-N.
| Molecular formula | C14H22BN3O4 |
|---|---|
| Molecular weight | 307.16 g/mol |
| IUPAC name | [6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-pyridinyl]boronic acid |
| InChIKey | SYZMMRYQYWCLNC-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)