cas: 412348-27-7 — see every product listed under this CAS number, including other names
1-Piperazinecarboxylic acid, 4-(6-bromo-3-pyridinyl)-, 1,1-dimethylethyl ester, 97%, 97% (CAS 412348-27-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D8N7-100mg |
| cas | 412348-27-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 962.00 Pln | |
| Chemat | 10g | 1773.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(6-bromo-3-pyridinyl)piperazine-1-carboxylate (CAS 412348-27-7) is a chemical compound with the molecular formula C14H20BrN3O2 and a molecular weight of 342.23 g/mol. IUPAC name: tert-butyl 4-(6-bromo-3-pyridinyl)piperazine-1-carboxylate. InChIKey: KALSTRGHEVNYFJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN3O2 |
|---|---|
| Molecular weight | 342.23 g/mol |
| IUPAC name | tert-butyl 4-(6-bromo-3-pyridinyl)piperazine-1-carboxylate |
| InChIKey | KALSTRGHEVNYFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CN=C(C=C2)Br |
Computed by PubChem (NCBI)