CAS 412348-27-7 appears in our catalog under these names: tert-Butyl 4-(6-bromopyridin-3-yl)piperazine-1-carboxylate, 95%, tert–Butyl 4–(6–bromopyridin–3–yl)piperazine–1–carboxylate, 1-Piperazinecarboxylic acid, 4-(6-bromo-3-pyridinyl)-, 1,1-dimethylethyl ester, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
Tert-butyl 4-(6-bromo-3-pyridinyl)piperazine-1-carboxylate (CAS 412348-27-7) is a chemical compound with the molecular formula C14H20BrN3O2 and a molecular weight of 342.23 g/mol. IUPAC name: tert-butyl 4-(6-bromo-3-pyridinyl)piperazine-1-carboxylate. InChIKey: KALSTRGHEVNYFJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN3O2 |
|---|---|
| Molecular weight | 342.23 g/mol |
| IUPAC name | tert-butyl 4-(6-bromo-3-pyridinyl)piperazine-1-carboxylate |
| InChIKey | KALSTRGHEVNYFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CN=C(C=C2)Br |
Computed by PubChem (NCBI)