cas: 1439823-01-4 — see every product listed under this CAS number, including other names
1-Piperidinecarboxylic acid, 4-(2,6-dichloro-4-pyrimidinyl)-, 1,1-dimethylethyl ester, 95%, 95% (CAS 1439823-01-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112IP9-50mg |
| cas | 1439823-01-4 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 323.60 Pln | |
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 726.80 Pln | |
| Chemat | 1g | 1907.60 Pln | |
| Chemat | 5g | 7682.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(2,6-dichloropyrimidin-4-yl)piperidine-1-carboxylate (CAS 1439823-01-4) is a chemical compound with the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.2 g/mol. IUPAC name: tert-butyl 4-(2,6-dichloropyrimidin-4-yl)piperidine-1-carboxylate. InChIKey: SMWIHIPPDLQJIX-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | tert-butyl 4-(2,6-dichloropyrimidin-4-yl)piperidine-1-carboxylate |
| InChIKey | SMWIHIPPDLQJIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)