cas: 1439823-01-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2,6-dichloropyrimidin-4-yl)piperidine-1-carboxylate 95% (CAS 1439823-01-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A147893-50mg |
| cas | 1439823-01-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 409.31 Pln | |
| Ambeed | 100mg | 481.62 Pln | |
| Ambeed | 250mg | 893.25 Pln | |
| Ambeed | 1g | 3351.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A147893 |
Tert-butyl 4-(2,6-dichloropyrimidin-4-yl)piperidine-1-carboxylate (CAS 1439823-01-4) is a chemical compound with the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.2 g/mol. IUPAC name: tert-butyl 4-(2,6-dichloropyrimidin-4-yl)piperidine-1-carboxylate. InChIKey: SMWIHIPPDLQJIX-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | tert-butyl 4-(2,6-dichloropyrimidin-4-yl)piperidine-1-carboxylate |
| InChIKey | SMWIHIPPDLQJIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)