cas: 827614-69-7 — see every product listed under this CAS number, including other names
1-Propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97% (CAS 827614-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021623-1G |
| cas | 827614-69-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 539.41 Pln | |
| Fluorochem | 25g | 1263.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 827614-69-7) is a chemical compound with the molecular formula C12H21BN2O2 and a molecular weight of 236.12 g/mol. IUPAC name: 1-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: BKLGYJWLZWMIDO-UHFFFAOYSA-N.
| Molecular formula | C12H21BN2O2 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 1-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | BKLGYJWLZWMIDO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCC |
Computed by PubChem (NCBI)