cas: 825630-80-6 — see every product listed under this CAS number, including other names
1-Pyrrolidineacetamide, N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-, 98+%, 98+% (CAS 825630-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0YT-100mg |
| cas | 825630-80-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 500mg | 1365.20 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
2-pyrrolidin-1-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 825630-80-6) is a chemical compound with the molecular formula C18H27BN2O3 and a molecular weight of 330.2 g/mol. IUPAC name: 2-pyrrolidin-1-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: AZRWWXWGBIEILY-UHFFFAOYSA-N.
| Molecular formula | C18H27BN2O3 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 2-pyrrolidin-1-yl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | AZRWWXWGBIEILY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)CN3CCCC3 |
Computed by PubChem (NCBI)