1-Tosylpiperazine hydrochloride, 98%, 98%
cas: 856843-84-0 — see every product listed under this CAS number, including other names
1-Tosylpiperazine hydrochloride, 98%, 98% (CAS 856843-84-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1161HX-1g |
| cas | 856843-84-0 |
| size | 1g |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 10g | 333.20 Pln | |
| Chemat | 25g | 654.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-methylphenyl)sulfonylpiperazine;hydrochloride (CAS 856843-84-0) is a chemical compound with the molecular formula C11H17ClN2O2S and a molecular weight of 276.78 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpiperazine;hydrochloride. InChIKey: IMLDHDNEYHSNDL-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O2S |
|---|---|
| Molecular weight | 276.78 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpiperazine;hydrochloride |
| InChIKey | IMLDHDNEYHSNDL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-Tosylpiperazine hydrochloride, 1-Tosylpiperazine HCl, 1-(4-methylbenzenesulfonyl)piperazine hydrochloride, 1-(4-methylphenyl)sulfonylpiperazine;hydrochloride, 1-[(4-methylphenyl)sulfonyl]piperazine hydrochloride, 1-Tosylpiperazinehydrochloride, 1-Tosylpiperazine hydrochloride, 98%, 1-(p-tolylsulfonyl)piperazine;hydrochloride, 1-(4-Methylbenzene-1-sulfonyl)piperazine--hydrogen chloride (1/1)