CAS 1174143-24-8 appears in our catalog under these names: 1-(Benzenesulfonyl)piperidin-4-amine hydrochloride, 98%, 1-(Benzenesulfonyl)piperidin-4-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 2,5g.
1-(benzenesulfonyl)piperidin-4-amine;hydrochloride (CAS 1174143-24-8) is a chemical compound with the molecular formula C11H17ClN2O2S and a molecular weight of 276.78 g/mol. IUPAC name: 1-(benzenesulfonyl)piperidin-4-amine;hydrochloride. InChIKey: BAOCNBVLYDBGJA-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O2S |
|---|---|
| Molecular weight | 276.78 g/mol |
| IUPAC name | 1-(benzenesulfonyl)piperidin-4-amine;hydrochloride |
| InChIKey | BAOCNBVLYDBGJA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)S(=O)(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)