1-allyl-3-vinylimidazolium chloride, 99%, 99%
cas: 100894-64-2 — see every product listed under this CAS number, including other names
1-allyl-3-vinylimidazolium chloride, 99%, 99% (CAS 100894-64-2) is a chemical reagent available from Chemat. Available pack sizes: 200g, 1g, 5g, 10g, 15g, 25g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11144Y-200g |
| cas | 100894-64-2 |
| size | 200g |
| availability | 1500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 200g | 938.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 15g | 155.60 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 50g | 314.00 Pln | |
| Chemat | 75g | 434.00 Pln | |
| Chemat | 100g | 496.40 Pln | |
| Chemat | 500g | 2112.00 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1-ethenyl-3-prop-2-enylimidazol-3-ium chloride (CAS 100894-64-2) is a chemical compound with the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. IUPAC name: 1-ethenyl-3-prop-2-enylimidazol-3-ium chloride. InChIKey: JPYCEKOMLYESGW-UHFFFAOYSA-M.
| Molecular formula | C8H11ClN2 |
|---|---|
| Molecular weight | 170.64 g/mol |
| IUPAC name | 1-ethenyl-3-prop-2-enylimidazol-3-ium chloride |
| InChIKey | JPYCEKOMLYESGW-UHFFFAOYSA-M |
| SMILES | C=CC[N+]1=CN(C=C1)C=C.[Cl-] |
Computed by PubChem (NCBI)