Products 100894-64-2
CAS 100894-64-2 appears in our catalog under these names: 1-Allyl-3-vinylimidazolium chloride, 95%, 1–allyl–3–vinylimidazolium chloride, 1-Allyl-3-vinylimidazolium chloride 99% mix TBC as stabilizer, 1-allyl-3-vinylimidazolium chloride, 99%, 99%, 1-ALLYL-3-VINYL-3-IMIDAZOLIUM CHLORIDE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 500g, 200g, 10g, 15g.
1-ethenyl-3-prop-2-enylimidazol-3-ium chloride (CAS 100894-64-2) is a chemical compound with the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. IUPAC name: 1-ethenyl-3-prop-2-enylimidazol-3-ium chloride. InChIKey: JPYCEKOMLYESGW-UHFFFAOYSA-M.
| Molecular formula | C8H11ClN2 |
|---|---|
| Molecular weight | 170.64 g/mol |
| IUPAC name | 1-ethenyl-3-prop-2-enylimidazol-3-ium chloride |
| InChIKey | JPYCEKOMLYESGW-UHFFFAOYSA-M |
| SMILES | C=CC[N+]1=CN(C=C1)C=C.[Cl-] |
Computed by PubChem (NCBI)