cas: 307492-75-7 — see every product listed under this CAS number, including other names
1-ethyl-2,3-dimethylimidazolium tetrafluoroborate 99% (CAS 307492-75-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A559260-25g |
| cas | 307492-75-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 398.19 Pln | |
| Ambeed | 500g | 1438.38 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A559260 |
1-ethyl-2,3-dimethylimidazol-3-ium tetrafluoroborate (CAS 307492-75-7) is a chemical compound with the molecular formula C7H13BF4N2 and a molecular weight of 212.00 g/mol. IUPAC name: 1-ethyl-2,3-dimethylimidazol-3-ium tetrafluoroborate. InChIKey: KNIWGPCMWBGRBE-UHFFFAOYSA-N.
| Molecular formula | C7H13BF4N2 |
|---|---|
| Molecular weight | 212.00 g/mol |
| IUPAC name | 1-ethyl-2,3-dimethylimidazol-3-ium tetrafluoroborate |
| InChIKey | KNIWGPCMWBGRBE-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCN1C=C[N+](=C1C)C |
Computed by PubChem (NCBI)