cas: 307492-75-7 — see every product listed under this CAS number, including other names
1-ethyl-2,3-dimethylimidazolium tetrafluoroborate, 97% (CAS 307492-75-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F544760-25G |
| cas | 307492-75-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 482.14 Pln | |
| Fluorochem | 500g | 1783.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-ethyl-2,3-dimethylimidazol-3-ium tetrafluoroborate (CAS 307492-75-7) is a chemical compound with the molecular formula C7H13BF4N2 and a molecular weight of 212.00 g/mol. IUPAC name: 1-ethyl-2,3-dimethylimidazol-3-ium tetrafluoroborate. InChIKey: KNIWGPCMWBGRBE-UHFFFAOYSA-N.
| Molecular formula | C7H13BF4N2 |
|---|---|
| Molecular weight | 212.00 g/mol |
| IUPAC name | 1-ethyl-2,3-dimethylimidazol-3-ium tetrafluoroborate |
| InChIKey | KNIWGPCMWBGRBE-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCN1C=C[N+](=C1C)C |
Computed by PubChem (NCBI)