cas: 861657-91-2 — see every product listed under this CAS number, including other names
1-tert-Butyl 2-methyl 5-oxopyrrolidine-1,2-dicarboxylate 95% (CAS 861657-91-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A452052-1g |
| cas | 861657-91-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2511.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A452052 |
1-O-tert-butyl 2-O-methyl 5-oxopyrrolidine-1,2-dicarboxylate (CAS 861657-91-2) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: FNTAOUUEQHKLIU-UHFFFAOYSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | FNTAOUUEQHKLIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(CCC1=O)C(=O)OC |
Computed by PubChem (NCBI)