1-tert-Butyl 3-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate 95%
cas: 1356338-74-3 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate 95% (CAS 1356338-74-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A298451-100mg |
| cas | 1356338-74-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 770.88 Pln | |
| Ambeed | 5g | 2528.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A298451 |
1-O-tert-butyl 3-O-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate (CAS 1356338-74-3) is a chemical compound with the molecular formula C13H19F2NO5 and a molecular weight of 307.29 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate. InChIKey: AUERBRVZUVQZFY-UHFFFAOYSA-N.
| Molecular formula | C13H19F2NO5 |
|---|---|
| Molecular weight | 307.29 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate |
| InChIKey | AUERBRVZUVQZFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CC(C1=O)(F)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
1-O-tert-butyl 3-O-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate, 1-tert-butyl3-ethyl5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate, Ethyl 1-Boc-5,5-difluoro-4-oxopiperidine-3-carboxylate, 3-Ethyl 1-boc-5,5-difluoro-4-oxopiperidine-3-carboxylate, 1-t-Butyl 3-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate, 1-tert-butyl 3-Ethyl 5,5-difluoro- 4-oxopiperidine-1,3-dicarboxylate, 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-4-oxo-1,3-piperidinedicarboxylate