cas: 1356338-74-3 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate, 95%, 95% (CAS 1356338-74-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUB2-100mg |
| cas | 1356338-74-3 |
| size | 100mg |
| availability | 3.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 549.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 3-O-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate (CAS 1356338-74-3) is a chemical compound with the molecular formula C13H19F2NO5 and a molecular weight of 307.29 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate. InChIKey: AUERBRVZUVQZFY-UHFFFAOYSA-N.
| Molecular formula | C13H19F2NO5 |
|---|---|
| Molecular weight | 307.29 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 5,5-difluoro-4-oxopiperidine-1,3-dicarboxylate |
| InChIKey | AUERBRVZUVQZFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CC(C1=O)(F)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)