cas: 1200497-67-1 — see every product listed under this CAS number, including other names
1-tert-Butyl 6-methyl 2,3-dihydro-1H-imidazo(1,2-b)pyrazole-1,6-dicarboxylate, 97% (CAS 1200497-67-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A415009-1g |
| cas | 1200497-67-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 16911.37 Pln | |
| AmBeed | 250mg | 6840.40 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-O-tert-butyl 6-O-methyl 2,3-dihydroimidazo[2,1-e]pyrazole-1,6-dicarboxylate (CAS 1200497-67-1) is a chemical compound with the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 2,3-dihydroimidazo[2,1-e]pyrazole-1,6-dicarboxylate. InChIKey: LGPJXYSOSAXTID-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O4 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 2,3-dihydroimidazo[2,1-e]pyrazole-1,6-dicarboxylate |
| InChIKey | LGPJXYSOSAXTID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C1=CC(=N2)C(=O)OC |
Computed by PubChem (NCBI)