CAS 880257-39-6 appears in our catalog under these names: 6-Boc-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4(1h,3h)-dione, 95%, 6-BOC-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE-2,4(1H,3H)-DIONE, 98+%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
Tert-butyl 2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxylate (CAS 880257-39-6) is a chemical compound with the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. IUPAC name: tert-butyl 2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxylate. InChIKey: JBLDCOQATXUSRZ-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O4 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | tert-butyl 2,4-dioxo-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxylate |
| InChIKey | JBLDCOQATXUSRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)