cas: 905735-75-3 — see every product listed under this CAS number, including other names
1-tert-Butyl 8-(2,5-dioxopyrrolidin-1-yl) octanedioate 95% (CAS 905735-75-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A568729-250mg |
| cas | 905735-75-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 3613.31 Pln | |
| Ambeed | 1g | 8919.94 Pln | |
| Ambeed | 5g | 16412.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A568729 |
1-O-tert-butyl 8-O-(2,5-dioxopyrrolidin-1-yl) octanedioate (CAS 905735-75-3) is a chemical compound with the molecular formula C16H25NO6 and a molecular weight of 327.37 g/mol. IUPAC name: 1-O-tert-butyl 8-O-(2,5-dioxopyrrolidin-1-yl) octanedioate. InChIKey: WNKBCGWPUFBYBA-UHFFFAOYSA-N.
| Molecular formula | C16H25NO6 |
|---|---|
| Molecular weight | 327.37 g/mol |
| IUPAC name | 1-O-tert-butyl 8-O-(2,5-dioxopyrrolidin-1-yl) octanedioate |
| InChIKey | WNKBCGWPUFBYBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)