Products 445312-77-6

CAS 445312-77-6 is the registry number for 1-tert-Butyl 3-methyl 4-oxo-3-(3-oxobutyl)piperidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-methyl 4-oxo-3-(3-oxobutyl)piperidine-1,3-dicarboxylate (CAS 445312-77-6) is a chemical compound with the molecular formula C16H25NO6 and a molecular weight of 327.37 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 4-oxo-3-(3-oxobutyl)piperidine-1,3-dicarboxylate. InChIKey: NAPDGVXWZIQXNN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25NO6
Molecular weight327.37 g/mol
IUPAC name1-O-tert-butyl 3-O-methyl 4-oxo-3-(3-oxobutyl)piperidine-1,3-dicarboxylate
InChIKeyNAPDGVXWZIQXNN-UHFFFAOYSA-N
SMILESCC(=O)CCC1(CN(CCC1=O)C(=O)OC(C)(C)C)C(=O)OC

Computed by PubChem (NCBI)