cas: 85590-00-7 — see every product listed under this CAS number, including other names
10-(Phosphonooxy)decyl methacrylate 95% (CAS 85590-00-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A269465-250mg |
| cas | 85590-00-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 10g | 414.88 Pln | |
| Ambeed | 25g | 854.31 Pln | |
| Ambeed | 100g | 2584.25 Pln | |
| Ambeed | 500g | 12635.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A269465 |
10-phosphonooxydecyl 2-methylprop-2-enoate (CAS 85590-00-7) is a chemical compound with the molecular formula C14H27O6P and a molecular weight of 322.33 g/mol. IUPAC name: 10-phosphonooxydecyl 2-methylprop-2-enoate. InChIKey: CFKBCVIYTWDYRP-UHFFFAOYSA-N.
| Molecular formula | C14H27O6P |
|---|---|
| Molecular weight | 322.33 g/mol |
| IUPAC name | 10-phosphonooxydecyl 2-methylprop-2-enoate |
| InChIKey | CFKBCVIYTWDYRP-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCCCCCCCCCOP(=O)(O)O |
Computed by PubChem (NCBI)