CAS 85590-00-7 appears in our catalog under these names: 10-Methacryloyldecylphosphate, >95% (HPLC), 10–(Phosphonooxy)decyl methacrylate, Estenia opaque primer, 10-(Phosphonooxy)decyl methacrylate 95%, 2-Propenoic acid, 2-methyl-, 10-(phosphonooxy)decyl ester, 95%, 95%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100g, 25g, 2g, 10g, 50g.
10-phosphonooxydecyl 2-methylprop-2-enoate (CAS 85590-00-7) is a chemical compound with the molecular formula C14H27O6P and a molecular weight of 322.33 g/mol. IUPAC name: 10-phosphonooxydecyl 2-methylprop-2-enoate. InChIKey: CFKBCVIYTWDYRP-UHFFFAOYSA-N.
| Molecular formula | C14H27O6P |
|---|---|
| Molecular weight | 322.33 g/mol |
| IUPAC name | 10-phosphonooxydecyl 2-methylprop-2-enoate |
| InChIKey | CFKBCVIYTWDYRP-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCCCCCCCCCOP(=O)(O)O |
Computed by PubChem (NCBI)