CAS 93496-77-6 is the registry number for 10-Bromoanthracene-9-carbaldehyde, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
10-bromoanthracene-9-carbaldehyde (CAS 93496-77-6) is a chemical compound with the molecular formula C15H9BrO and a molecular weight of 285.13 g/mol. IUPAC name: 10-bromoanthracene-9-carbaldehyde. InChIKey: YPRQOJZRPXMBMQ-UHFFFAOYSA-N.
| Molecular formula | C15H9BrO |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 10-bromoanthracene-9-carbaldehyde |
| InChIKey | YPRQOJZRPXMBMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Br)C=O |
Computed by PubChem (NCBI)