10-Bromoanthracene-9-carbaldehyde, 98%
cas: 93496-77-6 — see every product listed under this CAS number, including other names
10-Bromoanthracene-9-carbaldehyde, 98% (CAS 93496-77-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1925536-1g |
| cas | 93496-77-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 25g | 1888.94 Pln | |
| Ambeed | 100g | 6077.50 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 568.40 Pln | |
| Chemat | 25g | 1826.00 Pln | |
| Chemat | 100g | 5882.00 Pln | |
| BLDpharm | 1g | 219.95 Pln | |
| BLDpharm | 5g | 580.93 Pln | |
| BLDpharm | 25g | 1858.26 Pln | |
| BLDpharm | 100g | 5956.82 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
10-bromoanthracene-9-carbaldehyde (CAS 93496-77-6) is a chemical compound with the molecular formula C15H9BrO and a molecular weight of 285.13 g/mol. IUPAC name: 10-bromoanthracene-9-carbaldehyde. InChIKey: YPRQOJZRPXMBMQ-UHFFFAOYSA-N.
| Molecular formula | C15H9BrO |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 10-bromoanthracene-9-carbaldehyde |
| InChIKey | YPRQOJZRPXMBMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Br)C=O |
Computed by PubChem (NCBI)