CAS 17044-50-7 appears in our catalog under these names: 10-Bromo-5h-dibenzo[a,d][7]annulen-5-one, 95%, 4-Bromo-5H-dibenzo(a,d)cyclohepten-5-one, 10-Bromo-5h-dibenzo(a,d)(7)annulen-5-one, 95%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 50mg.
9-bromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one (CAS 17044-50-7) is a chemical compound with the molecular formula C15H9BrO and a molecular weight of 285.13 g/mol. IUPAC name: 9-bromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one. InChIKey: WYAFINWXANSYGR-UHFFFAOYSA-N.
| Molecular formula | C15H9BrO |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 9-bromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-one |
| InChIKey | WYAFINWXANSYGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C3C2=O)Br |
Computed by PubChem (NCBI)