cas: 1352827-47-4 — see every product listed under this CAS number, including other names
14-(2,5-Dioxo-1-pyrrolidinyl) 1-(9H-fluoren-9-ylmethyl) 5,8,11-trioxa-2-azatetradecanedioate, 95%, 95% (CAS 1352827-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU1A-100mg |
| cas | 1352827-47-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 832.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoate (CAS 1352827-47-4) is a chemical compound with the molecular formula C28H32N2O9 and a molecular weight of 540.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: KMYBRMLPVIWJEW-UHFFFAOYSA-N.
| Molecular formula | C28H32N2O9 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | KMYBRMLPVIWJEW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)