Fmoc-peg3-nhs ester 95%
cas: 1352827-47-4 — see every product listed under this CAS number, including other names
Fmoc-peg3-nhs ester 95% (CAS 1352827-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756131-100mg |
| cas | 1352827-47-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1165.81 Pln | |
| Ambeed | 5g | 3897.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756131 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoate (CAS 1352827-47-4) is a chemical compound with the molecular formula C28H32N2O9 and a molecular weight of 540.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: KMYBRMLPVIWJEW-UHFFFAOYSA-N.
| Molecular formula | C28H32N2O9 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | KMYBRMLPVIWJEW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)