cas: 86770-68-5 — see every product listed under this CAS number, including other names
14-Azido-3,6,9,12-tetraoxatetradecanol, 97% (CAS 86770-68-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DVC-100mg |
| cas | 86770-68-5 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 741.20 Pln | |
| Chemat | 10g | 1192.40 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3506.00 Pln | |
| Chemat | 100g | 5574.80 Pln | |
| Chemat | 250g | 8915.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanol (CAS 86770-68-5) is a chemical compound with the molecular formula C10H21N3O5 and a molecular weight of 263.29 g/mol. IUPAC name: 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanol. InChIKey: JTGGTGKXQQGEHB-UHFFFAOYSA-N.
| Molecular formula | C10H21N3O5 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | JTGGTGKXQQGEHB-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCO)N=[N+]=[N-] |
Computed by PubChem (NCBI)