CAS 40371-54-8 appears in our catalog under these names: Amikacin Impurity 3, Amikacin Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2,3,4-trihydroxycyclohexyl]-2-hydroxybutanamide (CAS 40371-54-8) is a chemical compound with the molecular formula C10H21N3O5 and a molecular weight of 263.29 g/mol. IUPAC name: (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2,3,4-trihydroxycyclohexyl]-2-hydroxybutanamide. InChIKey: LTIXNKHUZIJLEV-WEHQQBAWSA-N.
| Molecular formula | C10H21N3O5 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2,3,4-trihydroxycyclohexyl]-2-hydroxybutanamide |
| InChIKey | LTIXNKHUZIJLEV-WEHQQBAWSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1NC(=O)[C@H](CCN)O)O)O)O)N |
Computed by PubChem (NCBI)